2-[(3,4-dimethoxyphenyl)thio]acetic acid
2-(3,4-Dimethoxyphenylthio)acetic acid
CAS: 95735-63-0
Molecular Formula: C10H12O4S
2-[(3,4-dimethoxyphenyl)thio]acetic acid - Names and Identifiers
| Name | 2-(3,4-Dimethoxyphenylthio)acetic acid |
| Synonyms | 2-[(3,4-dimethoxyphenyl)thio]acetate [(3,4-dimethoxyphenyl)sulfanyl]acetate 2-(3,4-Dimethoxyphenylthio)acetic acid 2-(3,4-DIMETHOXYPHENYLTHIO)ACETIC ACID 2-[(3,4-dimethoxyphenyl)thio]acetic acid [(3,4-dimethoxyphenyl)sulfanyl]acetic acid |
| CAS | 95735-63-0 |
| InChI | InChI=1/C10H12O4S/c1-13-8-4-3-7(5-9(8)14-2)15-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
2-[(3,4-dimethoxyphenyl)thio]acetic acid - Physico-chemical Properties
| Molecular Formula | C10H12O4S |
| Molar Mass | 228.26 |
| Melting Point | 99-104 °C |
| Boling Point | 376.4°C at 760 mmHg |
| Flash Point | 181.4°C |
| Vapor Presure | 2.47E-06mmHg at 25°C |
2-[(3,4-dimethoxyphenyl)thio]acetic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Hazard Note | Irritant |
2-[(3,4-dimethoxyphenyl)thio]acetic acid - Introduction
2-(3,4-dimethoxyphenylthio) acetic acid is a compound with the formula C10H12O4S. It has the following properties:
1. Appearance: 2-(3,4-dimethoxyphenylthio) acetic acid is a white crystalline solid.
2. Solubility: It has good solubility in conventional organic solvents.
3. melting point: its melting point is about 95-98 degrees Celsius.
The main uses of 2-(3,4-Dimethoxyphenylthio)acetic acid are as follows:
1. Chemical reagent: It can be used as a reagent for organic synthesis and used for the synthesis of other organic compounds.
2. Pesticide intermediate: It can be used as an intermediate for synthetic pesticides and used in the production of agricultural fields.
3. Pharmaceutical field: It also has certain applications in drug research and development.
There are many methods for preparing 2-(3,4-Dimethoxyphenylthio)acetic acid, the most commonly used method is to prepare by the reaction of sulfurized benzyl alcohol. The specific preparation method is as follows:
1. First, 3,4-dimethoxyphenylethanol is reacted with sulfur and benzyl chloride in dichloromethane to obtain 3,4-dimethoxybenzathiol.
2. Then, 3,4-dimethoxybenzothiol is reacted with sodium hydroxide in acetonitrile to generate 2-(3,4-dimethoxyphenylthio) acetic acid.
Regarding the security information of 2-(3,4-Dimethoxyphenylthio)acetic acid, you need to pay attention to the following matters:
1. this compound is an organic compound, and the use and operation shall be carried out in accordance with the laboratory safety regulations.
2. contact with the compound, should avoid direct skin contact and inhalation of its dust or vapor, so as not to cause irritation or damage.
3. in the use of the process should wear appropriate personal protective equipment, such as gloves, glasses, etc.
4. during storage, contact with strong oxidants, acids and other substances should be avoided to avoid dangerous reactions.
1. Appearance: 2-(3,4-dimethoxyphenylthio) acetic acid is a white crystalline solid.
2. Solubility: It has good solubility in conventional organic solvents.
3. melting point: its melting point is about 95-98 degrees Celsius.
The main uses of 2-(3,4-Dimethoxyphenylthio)acetic acid are as follows:
1. Chemical reagent: It can be used as a reagent for organic synthesis and used for the synthesis of other organic compounds.
2. Pesticide intermediate: It can be used as an intermediate for synthetic pesticides and used in the production of agricultural fields.
3. Pharmaceutical field: It also has certain applications in drug research and development.
There are many methods for preparing 2-(3,4-Dimethoxyphenylthio)acetic acid, the most commonly used method is to prepare by the reaction of sulfurized benzyl alcohol. The specific preparation method is as follows:
1. First, 3,4-dimethoxyphenylethanol is reacted with sulfur and benzyl chloride in dichloromethane to obtain 3,4-dimethoxybenzathiol.
2. Then, 3,4-dimethoxybenzothiol is reacted with sodium hydroxide in acetonitrile to generate 2-(3,4-dimethoxyphenylthio) acetic acid.
Regarding the security information of 2-(3,4-Dimethoxyphenylthio)acetic acid, you need to pay attention to the following matters:
1. this compound is an organic compound, and the use and operation shall be carried out in accordance with the laboratory safety regulations.
2. contact with the compound, should avoid direct skin contact and inhalation of its dust or vapor, so as not to cause irritation or damage.
3. in the use of the process should wear appropriate personal protective equipment, such as gloves, glasses, etc.
4. during storage, contact with strong oxidants, acids and other substances should be avoided to avoid dangerous reactions.
Last Update：2024-04-09 21:21:28
![2-[(3,4-dimethoxyphenyl)thio]acetic acid](http://res.chembk.com/assets/str/2d/9/95/95735-63-0.png)